40% off

Ends in

--d--h--mLock in £90

Constructing Equations from Reacting Masses and Gas Volumes

Updated July 2026

Constructing chemical equations from experimental data is a fundamental skill in quantitative chemistry. By converting reacting masses or gas volumes into molar quantities, you can determine the stoichiometric ratios of a reaction. This allows for the identification of unknown substances and is essential for solving complex reactant to product problems in the ESAT.

Core concept

A balanced chemical equation represents the molar ratio of reactants and products in a reaction. Stoichiometric coefficients are derived by calculating the amount in moles (nn) of each substance using either n=mass/Mrn = \text{mass} / M_r for solids or the relative volume ratio for gases under constant conditions.

Stoichiometry and Molar Quantities

A balanced chemical equation provides the molar quantities of the substances involved in a reaction. For instance, the equation for the reaction of magnesium with oxygen, Mg(s)+12O2(g)MgO(s)Mg(s) + \frac{1}{2}O_2(g) \rightarrow MgO(s), indicates that 1 mole of magnesium reacts with 0.5 moles of oxygen gas to produce 1 mole of magnesium oxide. This fundamental relationship allows chemists to work backwards: if we know the experimental masses or volumes of the substances that reacted, we can calculate their molar ratios to determine the balanced equation.

Constructing Equations from Gas Volume Data

According to the properties of an ideal gas, the volume occupied by a gas depends on the temperature and pressure rather than the identity of the gas. Therefore, equal volumes of different gases, measured under the same conditions, contain the same number of moles. This simplifies the construction of equations for gaseous reactions, as the volume ratio of the reacting gases is directly equal to the ratio of their stoichiometric coefficients.

Worked Example: Combustion of a Gaseous Alkane

Suppose 100 cm3cm^3 of a gaseous alkane requires 500 cm3cm^3 of oxygen for complete combustion, with all volumes measured at the same temperature and pressure. To find the equation:

  1. Determine the volume ratio: The ratio of alkane to oxygen is 100:500100 : 500, which simplifies to 1:51 : 5.

  2. Apply Avogadro's law: This volume ratio is the mole ratio. Therefore, 1 mole of the alkane reacts with 5 moles of O2O_2.

  3. Use the general alkane formula: Let the alkane be CnH2n+2C_n H_{2n+2}. The unbalanced equation is CnH2n+2+5O2nCO2+(n+1)H2OC_n H_{2n+2} + 5O_2 \rightarrow nCO_2 + (n+1)H_2O.

  4. Balance the oxygen atoms: The total number of oxygen atoms in the products is 2n2n (from CO2CO_2) plus n+1n + 1 (from H2OH_2O), which equals 3n+13n + 1. On the reactant side, we have 5×2=105 \times 2 = 10 oxygen atoms.

  5. Solve for nn: 3n+1=103n=9n=33n + 1 = 10 \Rightarrow 3n = 9 \Rightarrow n = 3. The alkane is propane, C3H8C_3H_8. The balanced equation is C3H8(g)+5O2(g)3CO2(g)+4H2O(g)C_3H_8(g) + 5O_2(g) \rightarrow 3CO_2(g) + 4H_2O(g).

Constructing Equations from Reacting Masses

When dealing with solids or liquids, we use the mass and the relative molar mass (MrM_r) to find the number of moles. The steps are as follows:

  1. Calculate the number of moles of each substance using n=mass/Mrn = \text{mass} / M_r.
  2. Divide each molar amount by the smallest calculated value to find the simplest ratio.
  3. If necessary, multiply the results to obtain the smallest whole number integers.
  4. Place these integers as coefficients in the chemical equation.

Worked Example: Neutralisation of a Metal Hydroxide

In an experiment, 1.12 g of a metal hydroxide, QOHQOH (with Mr=56M_r = 56), is required to exactly neutralise a solution containing 0.98 g of sulfuric acid, H2SO4H_2SO_4.

  1. Calculate the moles of the hydroxide: n(QOH)=1.12/56=0.020n(QOH) = 1.12 / 56 = 0.020 mol.

  2. Calculate the moles of the acid: First, find the MrM_r of H2SO4H_2SO_4. Mr=(2×1.0)+32.0+(4×16.0)=98.0M_r = (2 \times 1.0) + 32.0 + (4 \times 16.0) = 98.0. Then, n(H2SO4)=0.98/98.0=0.010n(H_2SO_4) = 0.98 / 98.0 = 0.010 mol.

  3. Determine the ratio: The molar ratio of QOHQOH to H2SO4H_2SO_4 is 0.020:0.0100.020 : 0.010, which simplifies to 2:12 : 1.

  4. Construct the equation: The stoichiometric coefficients are 2 for the hydroxide and 1 for the acid. 2QOH(aq)+H2SO4(aq)Q2SO4(aq)+2H2O(l)2QOH(aq) + H_2SO_4(aq) \rightarrow Q_2SO_4(aq) + 2H_2O(l).

Key takeaways

  • Stoichiometric coefficients represent the ratio of moles, not the ratio of masses.
  • For gases under the same temperature and pressure, the volume ratio is identical to the mole ratio.
  • To determine a balanced equation from masses, convert all quantities to moles using n=m/Mrn = m / M_r.
  • If mole ratios are not whole numbers, multiply all values by a common factor to reach the simplest integer ratio.
Tips

When constructing an equation for the combustion of a hydrocarbon from volume data, always set the hydrocarbon coefficient to 1 and the other coefficients as relative ratios. This makes balancing the CC and HH atoms much faster.

Cautions

Never use the mass ratio as the coefficients in an equation. For example, in the reaction 2H2+O22H2O2H_2 + O_2 \rightarrow 2H_2O, the mass ratio is 4:324 : 32 (1:81 : 8), but the balancing coefficients are 2:12 : 1. Always convert to moles first.

Insight

This methodology allows chemists to deduce the formula of an unknown compound by reacting it with a known standard. For example, if you know the mass of an unknown acid and the moles of base needed to neutralise it, you can determine the acid's molar mass and basicity.

Frequently asked questions

Why can we use volumes directly for gas stoichiometry?

This is due to Avogadro's law, which states that equal volumes of all gases at the same temperature and pressure contain the same number of molecules. Because the number of moles is proportional to the number of molecules, the volume ratio and mole ratio are identical.

What should I do if the mass of a reactant is given in kilograms or tonnes?

You must convert the mass to grams before using the n=m/Mrn = m / M_r formula, as MrM_r is measured in grams per mole (g mol1g\ mol^{-1}). Remember that 1 kg = 1000 g and 1 tonne = 1,000,000 g.

How do I know which substance is the limiting reactant?

If you have the masses of multiple reactants, calculate the moles of each. Divide the moles of each by their respective coefficient in the balanced equation. The substance with the smallest resulting value is the limiting reactant.

Ready to test your knowledge?

You've reached the end of this section. Start a practice session to solidify your understanding and master this topic.