Gaseous Pollutants Origins and Effects for the ESAT

Updated July 2026

Understanding the origins and effects of gaseous pollutants is a vital part of the ESAT Chemistry syllabus. This guide covers the formation of carbon monoxide, carbon dioxide, sulfur dioxide, and nitrogen oxides through combustion and industrial processes, alongside their specific impacts on human health and the global environment.

Core concept

Gaseous pollutants like CO,CO2,SO2CO, CO_2, SO_2, and NOxNO_x are primarily produced by the combustion of fossil fuels, where variations in oxygen supply, fuel purity, and temperature determine which harmful substances are released into the atmosphere.

The Origins of Carbon Oxides

Carbon containing fuels, such as coal, oil, and natural gas, consist primarily of hydrocarbons. When these fuels are burned in a plentiful supply of oxygen, complete combustion occurs. The carbon atoms are fully oxidised to form carbon dioxide, CO2CO_2. The general equation for the complete combustion of a hydrocarbon can be represented by the reaction of methane: CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l).

However, if the oxygen supply is limited, incomplete combustion takes place. In this scenario, carbon is not fully oxidised, resulting in the formation of carbon monoxide, COCO, and sometimes carbon particulates (soot). The formation of carbon monoxide can be shown as: 2C(s)+O2(g)2CO(g)2C(s) + O_2(g) \rightarrow 2CO(g).

Environmental and Health Effects of Carbon Oxides

Carbon dioxide is a significant greenhouse gas. It absorbs infrared radiation that is reflected from the surface of the Earth, trapping heat within the atmosphere. While the greenhouse effect is a natural process that keeps the planet habitable, the excessive release of CO2CO_2 from burning fossil fuels is a primary driver of enhanced global warming and climate change.

Carbon monoxide is a highly toxic, colourless, and odourless gas, making it extremely dangerous as it cannot be easily detected by human senses. When inhaled, COCO binds irreversibly to the haemoglobin in red blood cells. Because haemoglobin has a much higher affinity for carbon monoxide than for oxygen, the blood becomes unable to transport sufficient oxygen to the body tissues and organs. This can lead to fainting, brain damage, and death.

Sulfur Dioxide and Acid Rain

Sulfur dioxide, SO2SO_2, is produced when fossil fuels containing sulfur impurities are burned. Most coal and some fractions of crude oil contain small amounts of sulfur. During combustion, this sulfur reacts with oxygen: S(s)+O2(g)SO2(g)S(s) + O_2(g) \rightarrow SO_2(g).

Once in the atmosphere, sulfur dioxide can react further with oxygen and water vapour to form sulfuric acid, H2SO4H_2SO_4. This is a major contributor to acid rain. Acid rain has several devastating effects: it acidifies lakes and rivers, killing fish and other aquatic life: it damages the waxy cuticle on the leaves of trees, making it difficult for them to absorb nutrients: and it reacts with metals and carbonate rocks, such as limestone and marble, causing buildings and statues to corrode and deteriorate. The reaction with limestone can be represented as: CaCO3(s)+H2SO4(aq)CaSO4(aq)+H2O(l)+CO2(g)CaCO_3(s) + H_2SO_4(aq) \rightarrow CaSO_4(aq) + H_2O(l) + CO_2(g).

Nitrogen Oxides and Their Impacts

Nitrogen oxides, collectively referred to as NOxNO_x, primarily include nitrogen monoxide, NONO, and nitrogen dioxide, NO2NO_2. Unlike carbon and sulfur oxides, nitrogen oxides do not usually come from impurities in the fuel itself. Instead, they form inside high temperature environments, such as internal combustion engines in cars.

At these high temperatures, the nitrogen and oxygen from the air, which are normally unreactive toward each other, gain enough energy to react: N2(g)+O2(g)2NO(g)N_2(g) + O_2(g) \rightarrow 2NO(g). This nitrogen monoxide then reacts with more oxygen in the air to form nitrogen dioxide: 2NO(g)+O2(g)2NO2(g)2NO(g) + O_2(g) \rightarrow 2NO_2(g).

Nitrogen oxides contribute to the formation of acid rain by reacting with water to produce nitric acid, HNO3HNO_3. Additionally, NOxNO_x gases are respiratory irritants that can aggravate conditions like asthma and contribute to the formation of photochemical smog, which reduces visibility and poses further health risks to the lungs.

Key takeaways

  • Carbon monoxide is a toxic product of incomplete combustion that prevents oxygen transport in the blood.
  • Carbon dioxide is a greenhouse gas produced by complete combustion that contributes to global warming.
  • Sulfur dioxide originates from sulfur impurities in fuels and is a primary cause of acid rain.
  • Nitrogen oxides form from the reaction of atmospheric nitrogen and oxygen at the high temperatures found in engines.
Tips

When answering ESAT questions, always check if the question specifies the origin of the pollutant. Remember that NOxNO_x is a temperature dependent product of the air, while SO2SO_2 is an impurity dependent product of the fuel.

Cautions

Do not confuse the effects of these gases. CO2CO_2 is related to the greenhouse effect, while SO2SO_2 and NOxNO_x are primarily related to acid rain. Carbon monoxide is the only one in this group that is directly toxic to humans via haemoglobin binding.

Insight

In modern vehicles, catalytic converters are used to reduce the emission of COCO and NOxNO_x by converting them into less harmful CO2CO_2 and N2N_2 through redox reactions on the surface of a platinum or rhodium catalyst.

Frequently asked questions

Why is carbon monoxide considered more dangerous than carbon dioxide in the short term?

Carbon monoxide is acutely toxic because it binds to haemoglobin 200 to 300 times more strongly than oxygen does. This leads to rapid oxygen starvation in the body, whereas carbon dioxide is not directly toxic at typical atmospheric concentrations.

How do nitrogen oxides form if nitrogen is an inert gas?

Nitrogen has a very strong triple bond that requires significant energy to break. The extremely high temperatures inside car engines provide the necessary activation energy for N2N_2 and O2O_2 from the intake air to react.

What is the difference between the origins of SO2SO_2 and NOxNO_x?

SO2SO_2 comes from sulfur that is physically present as an impurity within the fuel itself. NOxNO_x comes from the nitrogen already present in the air that is used to burn the fuel.

Can acid rain be caused by carbon dioxide?

While CO2CO_2 dissolves in water to form weak carbonic acid, making unpolluted rain slightly acidic (pH of approximately 5.6), the term acid rain usually refers to much more acidic precipitation (pH below 5.0) caused by SO2SO_2 and NOxNO_x.

Ready to test your knowledge?

You've reached the end of this section. Start a practice session to solidify your understanding and master this topic.