Chlorine and Fluoride Ions in Water Treatment for the ESAT

Updated July 2026

This section covers the chemical rationale behind adding specific ions to public water supplies. You will learn how chlorine acts as a powerful disinfectant to eliminate waterborne pathogens and how fluoride ions are utilised to strengthen dental enamel, reducing the prevalence of tooth decay across populations.

Core concept

Chlorine is added to drinking water to kill harmful bacteria and microbes through disinfection, while fluoride ions are added to prevent tooth decay by strengthening the mineral structure of tooth enamel.

The treatment of drinking water is a vital public health measure that involves several chemical processes. While filtration removes large particles and sediment, the addition of specific ions ensures the water is safe to drink and provides secondary health benefits. For the ESAT, you must distinguish between the biological safety provided by chlorine and the dental health benefits provided by fluoride ions.

The Purpose of Chlorine in Water Treatment

Chlorine is added to water supplies primarily as a disinfectant. Its main purpose is to kill bacteria, viruses, and other microorganisms that can cause waterborne diseases such as cholera and typhoid. When chlorine gas (Cl2Cl_{2}) is added to water, it undergoes a disproportionation reaction (a type of redox reaction where the same element is both oxidised and reduced) to form a mixture of acids:

Cl2(g)+H2O(l)HCl(aq)+HClO(aq)Cl_{2}(g) + H_{2}O(l) \rightleftharpoons HCl(aq) + HClO(aq)

In this reaction, HClOHClO is known as chloric(I) acid (or hypochlorous acid). This compound is a powerful oxidising agent that can penetrate the cell walls of bacteria and destroy their internal enzymes and genetic material, effectively neutralising the threat.

  1. Sterilisation: The primary goal is the destruction of pathogens.
  2. Residual Protection: A small, safe amount of chlorine is often left in the water to prevent re-contamination as the water travels through the pipe network to consumers.
  3. Taste and Odour: While effective, too much chlorine can give water a distinct chemical taste, which must be carefully monitored by water companies.

The Purpose of Fluoride Ions in Water Treatment

Unlike chlorine, fluoride ions (FF^{-}) are not added to make the water 'safe' in a biological sense. Instead, they are added for their medicinal benefits in preventing dental caries, also known as tooth decay.

Fluoride ions work by interacting with the enamel on human teeth. Enamel is primarily composed of a mineral called hydroxyapatite. When fluoride ions are present in drinking water, they can replace the hydroxide ions in the mineral to form fluorapatite:

Ca5(PO4)3(OH)+FCa5(PO4)3F+OHCa_{5}(PO_{4})_{3}(OH) + F^{-} \rightarrow Ca_{5}(PO_{4})_{3}F + OH^{-}

Fluorapatite is significantly harder and more resistant to acid attack from bacteria in the mouth than hydroxyapatite. This chemical change makes the teeth of the population, particularly children whose teeth are still developing, much less susceptible to cavities.

Ethical and Health Considerations

The addition of these ions is often a subject of debate. While the benefits of chlorine are almost universally accepted because it prevents immediate and deadly disease outbreaks, fluoridation is sometimes controversial. Some individuals view the mandatory addition of fluoride as a form of 'mass medication', arguing that people should have the choice whether or not to consume it. However, public health authorities generally maintain that the level of fluoride added (typically around 1 part per million) is safe and provides a massive benefit to lower-income communities who may have less access to dental care.

Example: Calculating Ion Concentration

A water treatment plant adds 2.12.1 kg of sodium fluoride (NaFNaF) to 1,000,0001,000,000 dm³ of water. Calculate the concentration of fluoride ions in mol dm⁻³.

Step 1: Find the relative formula mass (MrM_{r}) of NaFNaF. ArA_{r} values: Na=23.0Na = 23.0, F=19.0F = 19.0. Mr(NaF)=23.0+19.0=42.0M_{r}(NaF) = 23.0 + 19.0 = 42.0.

Step 2: Calculate the number of moles of NaFNaF. Mass in grams = 21002100 g. Moles=210042.0=50Moles = \frac{2100}{42.0} = 50 mol.

Step 3: Determine the concentration. Concentration=molesvolume=501,000,000=5×105Concentration = \frac{moles}{volume} = \frac{50}{1,000,000} = 5 \times 10^{-5} mol dm⁻³.

Exercises

Exercise 1: State the name of the active oxidising agent formed when chlorine reacts with water.

Exercise 2: Explain why fluoride is added to water even though it does not kill bacteria.

Solutions:

  1. Chloric(I) acid (or hypochlorous acid), HClOHClO.
  2. Fluoride is added to strengthen tooth enamel and prevent tooth decay by converting hydroxyapatite into acid-resistant fluorapatite.

Key takeaways

  • Chlorine is used as a disinfectant to kill bacteria and viruses in the water supply.
  • Chlorine reacts with water to form chloric(I) acid (HClOHClO), which is the active germicide.
  • Fluoride ions (FF^{-}) are added to drinking water to reduce tooth decay (dental caries).
  • Fluoride works by strengthening tooth enamel, making it more resistant to acid attack.
  • Chlorination is essential for biological safety, whereas fluoridation is a public health measure for dental hygiene.
Tips

In the ESAT, if a question asks about the 'safety' of water, focus on chlorine and disinfection. If it asks about 'health' or 'teeth', focus on fluoride. Do not confuse the two roles.

Cautions

Be careful with terminology. Chlorine gas (Cl2Cl_{2}) is added to water, but it forms chloride ions (ClCl^{-}) and chloric(I) acid (HClOHClO). The specification mentions 'chlorine ions', but you should know that the disinfecting power specifically comes from the reaction products of chlorine, not just the simple ClCl^{-} ion found in table salt.

Insight

The reaction of chlorine with water is a classic example of a disproportionation reaction. The chlorine in Cl2Cl_{2} (oxidation state 0) is reduced to 1-1 in HClHCl and oxidised to +1+1 in HClOHClO. This redox chemistry is what enables its effectiveness as a disinfectant.

Frequently asked questions

Is the chlorine in drinking water the same as the chlorine in swimming pools?

Yes, the chemical principle is the same. Both use chlorine to kill microbes, but the concentration in drinking water is much lower (usually less than 1 mg per litre) compared to swimming pools.

Does chlorine stay in the water forever?

No, chlorine is a volatile substance. If you leave a jug of tap water out for a few hours, much of the dissolved chlorine gas will escape into the air.

Why is fluoridation considered 'mass medication' by some?

Because it is the addition of a substance to a public supply intended to treat a medical condition (tooth decay) rather than to treat the water itself, meaning individuals cannot opt out if they use the public supply.

Can chlorine ions be toxic?

In the very low concentrations used for water treatment, chlorine is safe. However, in high concentrations, chlorine gas is toxic. This is why treatment levels are strictly regulated.

Ready to test your knowledge?

You've reached the end of this section. Start a practice session to solidify your understanding and master this topic.